C14H19N3O2 — CID 110469237
N-[3-[(1-phenylcyclopropyl)carbamoylamino]propyl]formamide (PubChem CID 110469237) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[3-[(1-phenylcyclopropyl)carbamoylamino]propyl]formamide.
| Compound Name | N-[3-[(1-phenylcyclopropyl)carbamoylamino]propyl]formamide |
|---|---|
| PubChem CID | 110469237 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-[3-[(1-phenylcyclopropyl)carbamoylamino]propyl]formamide |
| SMILES | O=CNCCCNC(=O)NC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H19N3O2/c18-11-15-9-4-10-16-13(19)17-14(7-8-14)12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-10H2,(H,15,18)(H2,16,17,19) |
| InChIKey | AHDYMOOTYLEXFU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|