C14H20N2O3 — CID 110490769
1-(2,2-dimethoxyethyl)-3-(1-phenylcyclopropyl)urea (PubChem CID 110490769) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-(1-phenylcyclopropyl)urea.
| Compound Name | 1-(2,2-dimethoxyethyl)-3-(1-phenylcyclopropyl)urea |
|---|---|
| PubChem CID | 110490769 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-(1-phenylcyclopropyl)urea |
| SMILES | COC(CNC(=O)NC1(c2ccccc2)CC1)OC |
| InChI | InChI=1S/C14H20N2O3/c1-18-12(19-2)10-15-13(17)16-14(8-9-14)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H2,15,16,17) |
| InChIKey | MLUZYRIQFBRWOT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|