C14H21N3O3 — CID 110491014
1-[1-(3-aminophenyl)cyclopropyl]-3-(2,2-dimethoxyethyl)urea (PubChem CID 110491014) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-[1-(3-aminophenyl)cyclopropyl]-3-(2,2-dimethoxyethyl)urea.
| Compound Name | 1-[1-(3-aminophenyl)cyclopropyl]-3-(2,2-dimethoxyethyl)urea |
|---|---|
| PubChem CID | 110491014 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-[1-(3-aminophenyl)cyclopropyl]-3-(2,2-dimethoxyethyl)urea |
| SMILES | COC(CNC(=O)NC1(c2cccc(N)c2)CC1)OC |
| InChI | InChI=1S/C14H21N3O3/c1-19-12(20-2)9-16-13(18)17-14(6-7-14)10-4-3-5-11(15)8-10/h3-5,8,12H,6-7,9,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | DRHCKDFFOREBDP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|