C13H15FN4O — CID 110469439
(7-fluoro-2H-indazol-3-yl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 110469439) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is (7-fluoro-2H-indazol-3-yl)-(4-methylpiperazin-1-yl)methanone.
| Compound Name | (7-fluoro-2H-indazol-3-yl)-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110469439 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (7-fluoro-2H-indazol-3-yl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2[nH]nc3c(F)cccc23)CC1 |
| InChI | InChI=1S/C13H15FN4O/c1-17-5-7-18(8-6-17)13(19)12-9-3-2-4-10(14)11(9)15-16-12/h2-4H,5-8H2,1H3,(H,15,16) |
| InChIKey | LRLWPCHZQQXCRJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |