C12H15F2N3O — CID 79767871
(3-amino-2,6-difluorophenyl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 79767871) has the molecular formula C12H15F2N3O and a molecular weight of 255.27 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-(4-methylpiperazin-1-yl)methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 79767871 |
| Molecular Formula | C12H15F2N3O |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2c(F)ccc(N)c2F)CC1 |
| InChI | InChI=1S/C12H15F2N3O/c1-16-4-6-17(7-5-16)12(18)10-8(13)2-3-9(15)11(10)14/h2-3H,4-7,15H2,1H3 |
| InChIKey | LSBJTQKRACQYQO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|