C11H12F2N2O3S — CID 79773364
(3-amino-2,6-difluorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 79773364) has the molecular formula C11H12F2N2O3S and a molecular weight of 290.29 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 79773364 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | Nc1ccc(F)c(C(=O)N2CCS(=O)(=O)CC2)c1F |
| InChI | InChI=1S/C11H12F2N2O3S/c12-7-1-2-8(14)10(13)9(7)11(16)15-3-5-19(17,18)6-4-15/h1-2H,3-6,14H2 |
| InChIKey | CMLQJPHDZKUIEM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|