C13H17F2N3O — CID 79772864
(3-amino-2,6-difluorophenyl)-(4-ethylpiperazin-1-yl)methanone (PubChem CID 79772864) has the molecular formula C13H17F2N3O and a molecular weight of 269.29 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 79772864 |
| Molecular Formula | C13H17F2N3O |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2c(F)ccc(N)c2F)CC1 |
| InChI | InChI=1S/C13H17F2N3O/c1-2-17-5-7-18(8-6-17)13(19)11-9(14)3-4-10(16)12(11)15/h3-4H,2,5-8,16H2,1H3 |
| InChIKey | MICGZMQJZPMPAW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|