C13H16F2N2O2 — CID 79772761
(3-amino-2,6-difluorophenyl)-[3-(methoxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 79772761) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-[3-(methoxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-[3-(methoxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 79772761 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-[3-(methoxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | COCC1CCN(C(=O)c2c(F)ccc(N)c2F)C1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-19-7-8-4-5-17(6-8)13(18)11-9(14)2-3-10(16)12(11)15/h2-3,8H,4-7,16H2,1H3 |
| InChIKey | WLPGSHJDBQKXPW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|