C12H17N3O — CID 110470220
(E)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)but-2-enamide (PubChem CID 110470220) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is (E)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)but-2-enamide.
| Compound Name | (E)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)but-2-enamide |
|---|---|
| PubChem CID | 110470220 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (E)-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)but-2-enamide |
| SMILES | C/C=C/C(=O)NC1CCCc2c1cnn2C |
| InChI | InChI=1S/C12H17N3O/c1-3-5-12(16)14-10-6-4-7-11-9(10)8-13-15(11)2/h3,5,8,10H,4,6-7H2,1-2H3,(H,14,16)/b5-3+ |
| InChIKey | YUTRYCWUFVQYSE-HWKANZROSA-N |
| XLogP | 1.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|