C14H24N4O — CID 43712066
6-amino-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)hexanamide (PubChem CID 43712066) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 6-amino-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)hexanamide.
| Compound Name | 6-amino-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)hexanamide |
|---|---|
| PubChem CID | 43712066 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 6-amino-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)hexanamide |
| SMILES | Cn1ncc2c1CCCC2NC(=O)CCCCCN |
| InChI | InChI=1S/C14H24N4O/c1-18-13-7-5-6-12(11(13)10-16-18)17-14(19)8-3-2-4-9-15/h10,12H,2-9,15H2,1H3,(H,17,19) |
| InChIKey | REGCGXBYGRAENB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|