C7H12N4O — CID 110470347
1,1-dimethyl-3-(1-methylimidazol-2-yl)urea (PubChem CID 110470347) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 1,1-dimethyl-3-(1-methylimidazol-2-yl)urea.
| Compound Name | 1,1-dimethyl-3-(1-methylimidazol-2-yl)urea |
|---|---|
| PubChem CID | 110470347 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1,1-dimethyl-3-(1-methylimidazol-2-yl)urea |
| SMILES | CN(C)C(=O)Nc1nccn1C |
| InChI | InChI=1S/C7H12N4O/c1-10(2)7(12)9-6-8-4-5-11(6)3/h4-5H,1-3H3,(H,8,9,12) |
| InChIKey | VMRUDUAMWQMBKB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |