C12H12FN3O — CID 110472886
2-(4-fluorophenyl)-N-(1-methylimidazol-2-yl)acetamide (PubChem CID 110472886) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(1-methylimidazol-2-yl)acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-(1-methylimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 110472886 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(1-methylimidazol-2-yl)acetamide |
| SMILES | Cn1ccnc1NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FN3O/c1-16-7-6-14-12(16)15-11(17)8-9-2-4-10(13)5-3-9/h2-7H,8H2,1H3,(H,14,15,17) |
| InChIKey | CVGJYHJUDMSWTG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |