C10H16N4O3 — CID 139662879
methyl (2S)-2-amino-5-[(1-methylimidazol-2-yl)amino]-5-oxopentanoate (PubChem CID 139662879) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-[(1-methylimidazol-2-yl)amino]-5-oxopentanoate.
| Compound Name | methyl (2S)-2-amino-5-[(1-methylimidazol-2-yl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 139662879 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | methyl (2S)-2-amino-5-[(1-methylimidazol-2-yl)amino]-5-oxopentanoate |
| SMILES | COC(=O)[C@@H](N)CCC(=O)Nc1nccn1C |
| InChI | InChI=1S/C10H16N4O3/c1-14-6-5-12-10(14)13-8(15)4-3-7(11)9(16)17-2/h5-7H,3-4,11H2,1-2H3,(H,12,13,15)/t7-/m0/s1 |
| InChIKey | NFPVWLUTDNHDPE-ZETCQYMHSA-N |
| XLogP | -0.36 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |