C9H10N4O — CID 110470457
N-(3-cyano-2-pyridinyl)-2-(methylamino)acetamide (PubChem CID 110470457) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is N-(3-cyano-2-pyridinyl)-2-(methylamino)acetamide.
| Compound Name | N-(3-cyano-2-pyridinyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 110470457 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-(3-cyano-2-pyridinyl)-2-(methylamino)acetamide |
| SMILES | CNCC(=O)Nc1ncccc1C#N |
| InChI | InChI=1S/C9H10N4O/c1-11-6-8(14)13-9-7(5-10)3-2-4-12-9/h2-4,11H,6H2,1H3,(H,12,13,14) |
| InChIKey | ZDWMBSFIOOGQOG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |