C11H15NO4S — CID 110470575
2-methoxy-N-[(2-methylsulfonylphenyl)methyl]acetamide (PubChem CID 110470575) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-methoxy-N-[(2-methylsulfonylphenyl)methyl]acetamide.
| Compound Name | 2-methoxy-N-[(2-methylsulfonylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 110470575 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-methoxy-N-[(2-methylsulfonylphenyl)methyl]acetamide |
| SMILES | COCC(=O)NCc1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C11H15NO4S/c1-16-8-11(13)12-7-9-5-3-4-6-10(9)17(2,14)15/h3-6H,7-8H2,1-2H3,(H,12,13) |
| InChIKey | ZPCJSSCYMGCSBP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |