C23H17N3O3 — CID 11047219
7-[(3-nitrophenyl)methyl]-7,12-dihydroisoquinolino[2,3-a]quinazolin-5-one (PubChem CID 11047219) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 7-[(3-nitrophenyl)methyl]-7,12-dihydroisoquinolino[2,3-a]quinazolin-5-one.
| Compound Name | 7-[(3-nitrophenyl)methyl]-7,12-dihydroisoquinolino[2,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 11047219 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 7-[(3-nitrophenyl)methyl]-7,12-dihydroisoquinolino[2,3-a]quinazolin-5-one |
| SMILES | O=c1nc2n(c3ccccc13)Cc1ccccc1C2Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17N3O3/c27-23-19-10-3-4-11-21(19)25-14-16-7-1-2-9-18(16)20(22(25)24-23)13-15-6-5-8-17(12-15)26(28)29/h1-12,20H,13-14H2 |
| InChIKey | DDAWFRWBEGFZNM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|