C24H21N3O2 — CID 162399611
1-(1H-indol-3-yl)-2-[(3-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 162399611) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-[(3-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-(1H-indol-3-yl)-2-[(3-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 162399611 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-[(3-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | O=[N+]([O-])c1cccc(CN2CCc3ccccc3C2c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H21N3O2/c28-27(29)19-8-5-6-17(14-19)16-26-13-12-18-7-1-2-9-20(18)24(26)22-15-25-23-11-4-3-10-21(22)23/h1-11,14-15,24-25H,12-13,16H2 |
| InChIKey | HGDUDNJMAIJLTG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|