C21H20ClN3O2 — CID 46032361
1-(2-chlorophenyl)-2-[(3-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 46032361) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-[(3-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 1-(2-chlorophenyl)-2-[(3-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 46032361 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-(2-chlorophenyl)-2-[(3-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | O=[N+]([O-])c1cccc(CN2CCCn3cccc3C2c2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O2/c22-19-9-2-1-8-18(19)21-20-10-4-11-23(20)12-5-13-24(21)15-16-6-3-7-17(14-16)25(26)27/h1-4,6-11,14,21H,5,12-13,15H2 |
| InChIKey | AILYGYDEOHGTKG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|