C22H21ClN4O5 — CID 46032799
1-(2-chloro-5-nitrophenyl)-2-[(2-methoxy-5-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 46032799) has the molecular formula C22H21ClN4O5 and a molecular weight of 456.89 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-2-[(2-methoxy-5-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-2-[(2-methoxy-5-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 46032799 |
| Molecular Formula | C22H21ClN4O5 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-2-[(2-methoxy-5-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CCCn2cccc2C1c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C22H21ClN4O5/c1-32-21-8-6-16(26(28)29)12-15(21)14-25-11-3-10-24-9-2-4-20(24)22(25)18-13-17(27(30)31)5-7-19(18)23/h2,4-9,12-13,22H,3,10-11,14H2,1H3 |
| InChIKey | ALCJNAVBAWGNRN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 103.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|