C22H21F2N3O3 — CID 46032848
1-(3,4-difluorophenyl)-2-[(2-methoxy-5-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 46032848) has the molecular formula C22H21F2N3O3 and a molecular weight of 413.42 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-[(2-methoxy-5-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 1-(3,4-difluorophenyl)-2-[(2-methoxy-5-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 46032848 |
| Molecular Formula | C22H21F2N3O3 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-[(2-methoxy-5-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CCCn2cccc2C1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H21F2N3O3/c1-30-21-8-6-17(27(28)29)12-16(21)14-26-11-3-10-25-9-2-4-20(25)22(26)15-5-7-18(23)19(24)13-15/h2,4-9,12-13,22H,3,10-11,14H2,1H3 |
| InChIKey | DUUZJERVEQZHBQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 60.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|