C23H22F3N3O4 — CID 93231491
2-methoxy-4-nitro-6-[[(1R)-1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]phenol (PubChem CID 93231491) has the molecular formula C23H22F3N3O4 and a molecular weight of 461.44 g/mol. Its IUPAC name is 2-methoxy-4-nitro-6-[[(1R)-1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]phenol.
| Compound Name | 2-methoxy-4-nitro-6-[[(1R)-1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 93231491 |
| Molecular Formula | C23H22F3N3O4 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-methoxy-4-nitro-6-[[(1R)-1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]phenol |
| SMILES | COc1cc([N+](=O)[O-])cc(CN2CCCn3cccc3[C@H]2c2ccc(C(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C23H22F3N3O4/c1-33-20-13-18(29(31)32)12-16(22(20)30)14-28-11-3-10-27-9-2-4-19(27)21(28)15-5-7-17(8-6-15)23(24,25)26/h2,4-9,12-13,21,30H,3,10-11,14H2,1H3/t21-/m1/s1 |
| InChIKey | NKTSASJPVPZTIB-OAQYLSRUSA-N |
| XLogP | 5.12 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|