C22H23N3O4 — CID 42845720
2-methoxy-5-[2-[(3-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-1-yl]phenol (PubChem CID 42845720) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-methoxy-5-[2-[(3-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-1-yl]phenol.
| Compound Name | 2-methoxy-5-[2-[(3-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-1-yl]phenol |
|---|---|
| PubChem CID | 42845720 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-methoxy-5-[2-[(3-nitrophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-1-yl]phenol |
| SMILES | COc1ccc(C2c3cccn3CCCN2Cc2cccc([N+](=O)[O-])c2)cc1O |
| InChI | InChI=1S/C22H23N3O4/c1-29-21-9-8-17(14-20(21)26)22-19-7-3-10-23(19)11-4-12-24(22)15-16-5-2-6-18(13-16)25(27)28/h2-3,5-10,13-14,22,26H,4,11-12,15H2,1H3 |
| InChIKey | GGSQOSHWLCMZKY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|