C22H21F3N2O2 — CID 46032358
4-[[1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]benzene-1,3-diol (PubChem CID 46032358) has the molecular formula C22H21F3N2O2 and a molecular weight of 402.42 g/mol. Its IUPAC name is 4-[[1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]benzene-1,3-diol.
| Compound Name | 4-[[1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 46032358 |
| Molecular Formula | C22H21F3N2O2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-[[1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CN2CCCn3cccc3C2c2ccc(C(F)(F)F)cc2)c(O)c1 |
| InChI | InChI=1S/C22H21F3N2O2/c23-22(24,25)17-7-4-15(5-8-17)21-19-3-1-10-26(19)11-2-12-27(21)14-16-6-9-18(28)13-20(16)29/h1,3-10,13,21,28-29H,2,11-12,14H2 |
| InChIKey | TZJIDFLQZHVISM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|