C22H19Cl2F3N2 — CID 93231581
(1R)-1-(3,4-dichlorophenyl)-2-[[2-(trifluoromethyl)phenyl]methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 93231581) has the molecular formula C22H19Cl2F3N2 and a molecular weight of 439.31 g/mol. Its IUPAC name is (1R)-1-(3,4-dichlorophenyl)-2-[[2-(trifluoromethyl)phenyl]methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | (1R)-1-(3,4-dichlorophenyl)-2-[[2-(trifluoromethyl)phenyl]methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 93231581 |
| Molecular Formula | C22H19Cl2F3N2 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (1R)-1-(3,4-dichlorophenyl)-2-[[2-(trifluoromethyl)phenyl]methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | FC(F)(F)c1ccccc1CN1CCCn2cccc2[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2F3N2/c23-18-9-8-15(13-19(18)24)21-20-7-3-10-28(20)11-4-12-29(21)14-16-5-1-2-6-17(16)22(25,26)27/h1-3,5-10,13,21H,4,11-12,14H2/t21-/m1/s1 |
| InChIKey | KREAUFDUBKJXMS-OAQYLSRUSA-N |
| XLogP | 6.81 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |