C22H23FN2O — CID 93231733
2-[[(1R)-1-(4-fluorophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-4-methylphenol (PubChem CID 93231733) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-[[(1R)-1-(4-fluorophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-4-methylphenol.
| Compound Name | 2-[[(1R)-1-(4-fluorophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 93231733 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-[[(1R)-1-(4-fluorophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(CN2CCCn3cccc3[C@H]2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H23FN2O/c1-16-5-10-21(26)18(14-16)15-25-13-3-12-24-11-2-4-20(24)22(25)17-6-8-19(23)9-7-17/h2,4-11,14,22,26H,3,12-13,15H2,1H3/t22-/m1/s1 |
| InChIKey | QOWBQOJZIKWCIV-JOCHJYFZSA-N |
| XLogP | 4.64 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|