C15H22N4O — CID 110476308
N-[3-(diethylamino)propyl]imidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 110476308) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]imidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]imidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 110476308 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-[3-(diethylamino)propyl]imidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccn2cncc2c1 |
| InChI | InChI=1S/C15H22N4O/c1-3-18(4-2)8-5-7-17-15(20)13-6-9-19-12-16-11-14(19)10-13/h6,9-12H,3-5,7-8H2,1-2H3,(H,17,20) |
| InChIKey | JGRMFXSDEFSMIJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|