C29H40N4O4 — CID 515386
2-N,7-N-bis[3-(diethylamino)propyl]-9-oxoxanthene-2,7-dicarboxamide (PubChem CID 515386) has the molecular formula C29H40N4O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-N,7-N-bis[3-(diethylamino)propyl]-9-oxoxanthene-2,7-dicarboxamide.
| Compound Name | 2-N,7-N-bis[3-(diethylamino)propyl]-9-oxoxanthene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 515386 |
| Molecular Formula | C29H40N4O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 2-N,7-N-bis[3-(diethylamino)propyl]-9-oxoxanthene-2,7-dicarboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc2oc3ccc(C(=O)NCCCN(CC)CC)cc3c(=O)c2c1 |
| InChI | InChI=1S/C29H40N4O4/c1-5-32(6-2)17-9-15-30-28(35)21-11-13-25-23(19-21)27(34)24-20-22(12-14-26(24)37-25)29(36)31-16-10-18-33(7-3)8-4/h11-14,19-20H,5-10,15-18H2,1-4H3,(H,30,35)(H,31,36) |
| InChIKey | BKZQSPFYUDDKFF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|