C31H42N6O4 — CID 54338872
2-N,7-N-bis[3-(4-methylpiperazin-1-yl)propyl]-9-oxoxanthene-2,7-dicarboxamide (PubChem CID 54338872) has the molecular formula C31H42N6O4 and a molecular weight of 562.72 g/mol. Its IUPAC name is 2-N,7-N-bis[3-(4-methylpiperazin-1-yl)propyl]-9-oxoxanthene-2,7-dicarboxamide.
| Compound Name | 2-N,7-N-bis[3-(4-methylpiperazin-1-yl)propyl]-9-oxoxanthene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 54338872 |
| Molecular Formula | C31H42N6O4 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 2-N,7-N-bis[3-(4-methylpiperazin-1-yl)propyl]-9-oxoxanthene-2,7-dicarboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2ccc3oc4ccc(C(=O)NCCCN5CCN(C)CC5)cc4c(=O)c3c2)CC1 |
| InChI | InChI=1S/C31H42N6O4/c1-34-13-17-36(18-14-34)11-3-9-32-30(39)23-5-7-27-25(21-23)29(38)26-22-24(6-8-28(26)41-27)31(40)33-10-4-12-37-19-15-35(2)16-20-37/h5-8,21-22H,3-4,9-20H2,1-2H3,(H,32,39)(H,33,40) |
| InChIKey | TXMSBPQVGONLOC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|