C14H17NO4 — CID 110477356
N-(5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-4-yl)-3-oxobutanamide (PubChem CID 110477356) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is N-(5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-4-yl)-3-oxobutanamide.
| Compound Name | N-(5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-4-yl)-3-oxobutanamide |
|---|---|
| PubChem CID | 110477356 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N-(5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-4-yl)-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NC1CCOc2ccccc2C1O |
| InChI | InChI=1S/C14H17NO4/c1-9(16)8-13(17)15-11-6-7-19-12-5-3-2-4-10(12)14(11)18/h2-5,11,14,18H,6-8H2,1H3,(H,15,17) |
| InChIKey | YGZLVKWWPYAJEV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|