C13H17NO2S — CID 110477808
methyl N-[[1-(2-methylsulfanylphenyl)cyclopropyl]methyl]carbamate (PubChem CID 110477808) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is methyl N-[[1-(2-methylsulfanylphenyl)cyclopropyl]methyl]carbamate.
| Compound Name | methyl N-[[1-(2-methylsulfanylphenyl)cyclopropyl]methyl]carbamate |
|---|---|
| PubChem CID | 110477808 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | methyl N-[[1-(2-methylsulfanylphenyl)cyclopropyl]methyl]carbamate |
| SMILES | COC(=O)NCC1(c2ccccc2SC)CC1 |
| InChI | InChI=1S/C13H17NO2S/c1-16-12(15)14-9-13(7-8-13)10-5-3-4-6-11(10)17-2/h3-6H,7-9H2,1-2H3,(H,14,15) |
| InChIKey | ZIRHVYAPVCCAPJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |