C15H17N3O — CID 110479984
4-amino-N-(6-phenyl-2-pyridinyl)butanamide (PubChem CID 110479984) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-amino-N-(6-phenyl-2-pyridinyl)butanamide.
| Compound Name | 4-amino-N-(6-phenyl-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 110479984 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-amino-N-(6-phenyl-2-pyridinyl)butanamide |
| SMILES | NCCCC(=O)Nc1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H17N3O/c16-11-5-10-15(19)18-14-9-4-8-13(17-14)12-6-2-1-3-7-12/h1-4,6-9H,5,10-11,16H2,(H,17,18,19) |
| InChIKey | OYMXMPCNDYIBLO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |