C11H20N2O — CID 110481075
(2E,4E)-N-[2-(dimethylamino)ethyl]-N-methylhexa-2,4-dienamide (PubChem CID 110481075) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (2E,4E)-N-[2-(dimethylamino)ethyl]-N-methylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[2-(dimethylamino)ethyl]-N-methylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 110481075 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (2E,4E)-N-[2-(dimethylamino)ethyl]-N-methylhexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)N(C)CCN(C)C |
| InChI | InChI=1S/C11H20N2O/c1-5-6-7-8-11(14)13(4)10-9-12(2)3/h5-8H,9-10H2,1-4H3/b6-5+,8-7+ |
| InChIKey | YJBZJSYCHCMQNV-BSWSSELBSA-N |
| XLogP | 1.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|