C24H27NO4S — CID 11048171
methyl (3aR,7aS)-4-methyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate (PubChem CID 11048171) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is methyl (3aR,7aS)-4-methyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate.
| Compound Name | methyl (3aR,7aS)-4-methyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 11048171 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | methyl (3aR,7aS)-4-methyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate |
| SMILES | COC(=O)C1C(c2ccccc2)=C[C@@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]2C1C |
| InChI | InChI=1S/C24H27NO4S/c1-16-9-11-20(12-10-16)30(27,28)25-14-19-13-21(18-7-5-4-6-8-18)23(24(26)29-3)17(2)22(19)15-25/h4-13,17,19,22-23H,14-15H2,1-3H3/t17?,19-,22-,23?/m1/s1 |
| InChIKey | DFCHITKYCNMPCO-QQSBWOQRSA-N |
| XLogP | 3.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |