C13H16N4O3 — CID 110481840
ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methylamino]-2-oxoacetate (PubChem CID 110481840) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 110481840 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCc1cnn2c(C)cc(C)nc12 |
| InChI | InChI=1S/C13H16N4O3/c1-4-20-13(19)12(18)14-6-10-7-15-17-9(3)5-8(2)16-11(10)17/h5,7H,4,6H2,1-3H3,(H,14,18) |
| InChIKey | XTJUQHXFHJOVAM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|