C16H20FNO — CID 110482201
N-[1-(2-fluorophenyl)cyclopropyl]cyclohexanecarboxamide (PubChem CID 110482201) has the molecular formula C16H20FNO and a molecular weight of 261.34 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)cyclopropyl]cyclohexanecarboxamide.
| Compound Name | N-[1-(2-fluorophenyl)cyclopropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110482201 |
| Molecular Formula | C16H20FNO |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-[1-(2-fluorophenyl)cyclopropyl]cyclohexanecarboxamide |
| SMILES | O=C(NC1(c2ccccc2F)CC1)C1CCCCC1 |
| InChI | InChI=1S/C16H20FNO/c17-14-9-5-4-8-13(14)16(10-11-16)18-15(19)12-6-2-1-3-7-12/h4-5,8-9,12H,1-3,6-7,10-11H2,(H,18,19) |
| InChIKey | JUNLDNFJPPYURX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |