C21H26F2N2O2 — CID 166415999
N-[1-(2,3-difluorophenyl)cyclohexyl]-1-prop-2-enoylpiperidine-4-carboxamide (PubChem CID 166415999) has the molecular formula C21H26F2N2O2 and a molecular weight of 376.45 g/mol. Its IUPAC name is N-[1-(2,3-difluorophenyl)cyclohexyl]-1-prop-2-enoylpiperidine-4-carboxamide.
| Compound Name | N-[1-(2,3-difluorophenyl)cyclohexyl]-1-prop-2-enoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 166415999 |
| Molecular Formula | C21H26F2N2O2 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-[1-(2,3-difluorophenyl)cyclohexyl]-1-prop-2-enoylpiperidine-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(C(=O)NC2(c3cccc(F)c3F)CCCCC2)CC1 |
| InChI | InChI=1S/C21H26F2N2O2/c1-2-18(26)25-13-9-15(10-14-25)20(27)24-21(11-4-3-5-12-21)16-7-6-8-17(22)19(16)23/h2,6-8,15H,1,3-5,9-14H2,(H,24,27) |
| InChIKey | KYZZUCVLNLMLGQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|