C16H15F5N2O2 — CID 166405641
N-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-prop-2-enoylpiperidine-4-carboxamide (PubChem CID 166405641) has the molecular formula C16H15F5N2O2 and a molecular weight of 362.30 g/mol. Its IUPAC name is N-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-prop-2-enoylpiperidine-4-carboxamide.
| Compound Name | N-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-prop-2-enoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 166405641 |
| Molecular Formula | C16H15F5N2O2 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-prop-2-enoylpiperidine-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(C(=O)NCc2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H15F5N2O2/c1-2-10(24)23-5-3-8(4-6-23)16(25)22-7-9-11(17)13(19)15(21)14(20)12(9)18/h2,8H,1,3-7H2,(H,22,25) |
| InChIKey | HUMXAQVQZHCJQF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|