C17H20N2O5 — CID 166420165
N-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-1-prop-2-enoylpyrrolidine-3-carboxamide (PubChem CID 166420165) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-1-prop-2-enoylpyrrolidine-3-carboxamide.
| Compound Name | N-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-1-prop-2-enoylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166420165 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-1-prop-2-enoylpyrrolidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCC(C(=O)NCc2cc3c(cc2OC)OCO3)C1 |
| InChI | InChI=1S/C17H20N2O5/c1-3-16(20)19-5-4-11(9-19)17(21)18-8-12-6-14-15(24-10-23-14)7-13(12)22-2/h3,6-7,11H,1,4-5,8-10H2,2H3,(H,18,21) |
| InChIKey | PHHWMXTUPODLRV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|