C21H27FN2O4 — CID 166405629
N-[4-(3-fluoro-4-methoxyphenyl)oxan-4-yl]-1-prop-2-enoylpiperidine-4-carboxamide (PubChem CID 166405629) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[4-(3-fluoro-4-methoxyphenyl)oxan-4-yl]-1-prop-2-enoylpiperidine-4-carboxamide.
| Compound Name | N-[4-(3-fluoro-4-methoxyphenyl)oxan-4-yl]-1-prop-2-enoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 166405629 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-[4-(3-fluoro-4-methoxyphenyl)oxan-4-yl]-1-prop-2-enoylpiperidine-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(C(=O)NC2(c3ccc(OC)c(F)c3)CCOCC2)CC1 |
| InChI | InChI=1S/C21H27FN2O4/c1-3-19(25)24-10-6-15(7-11-24)20(26)23-21(8-12-28-13-9-21)16-4-5-18(27-2)17(22)14-16/h3-5,14-15H,1,6-13H2,2H3,(H,23,26) |
| InChIKey | JARGZQNKLPLQCZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|