About N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide
N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide (PubChem CID 167818858) has the molecular formula C19H22N2O5
and a molecular weight of 358.39 g/mol. Its IUPAC name is N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide |
| PubChem CID | 167818858 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(C(=O)NC2COc3c(OC)cccc3C2=O)CC1 |
| InChI | InChI=1S/C19H22N2O5/c1-3-16(22)21-9-7-12(8-10-21)19(24)20-14-11-26-18-13(17(14)23)5-4-6-15(18)25-2/h3-6,12,14H,1,7-11H2,2H3,(H,20,24) |
| InChIKey | ZLAXFDVSACVLJM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide?
The IUPAC name of N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide (CID 167818858) is N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide.
What is the SMILES notation for N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide?
The canonical SMILES for N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide is C=CC(=O)N1CCC(C(=O)NC2COc3c(OC)cccc3C2=O)CC1.
What is the InChIKey of N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide?
The InChIKey is ZLAXFDVSACVLJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O5/c1-3-16(22)21-9-7-12(8-10-21)19(24)20-14-11-26-18-13(17(14)23)5-4-6-15(18)25-2/h3-6,12,14H,1,7-11H2,2H3,(H,20,24).
What are the key properties of N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide?
N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide has a molecular weight of 358.39 g/mol, XLogP of 1.18, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-methoxy-4-oxo-2,3-dihydrochromen-3-yl)-1-prop-2-enoylpiperidine-4-carboxamide is sourced from PubChem (CID 167818858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).