C19H22F2N2O2 — CID 166403460
1-[4-[3-fluoro-3-(2-fluorophenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166403460) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-[4-[3-fluoro-3-(2-fluorophenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-fluoro-3-(2-fluorophenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166403460 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[4-[3-fluoro-3-(2-fluorophenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C(=O)N2CCC(F)(c3ccccc3F)C2)CC1 |
| InChI | InChI=1S/C19H22F2N2O2/c1-2-17(24)22-10-7-14(8-11-22)18(25)23-12-9-19(21,13-23)15-5-3-4-6-16(15)20/h2-6,14H,1,7-13H2 |
| InChIKey | VSPSOPJOLVMUOL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|