C13H14F3NO — CID 110486480
N-propyl-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide (PubChem CID 110486480) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is N-propyl-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-propyl-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110486480 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-propyl-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide |
| SMILES | CCCNC(=O)C1(c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C13H14F3NO/c1-2-7-17-12(18)13(5-6-13)8-3-4-9(14)11(16)10(8)15/h3-4H,2,5-7H2,1H3,(H,17,18) |
| InChIKey | KCTUMIWPZJYVGV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|