About N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide
N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide (PubChem CID 110486476) has the molecular formula C12H13F3N2O
and a molecular weight of 258.24 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide |
| PubChem CID | 110486476 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NCCNC(=O)C1(c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C12H13F3N2O/c13-8-2-1-7(9(14)10(8)15)12(3-4-12)11(18)17-6-5-16/h1-2H,3-6,16H2,(H,17,18) |
| InChIKey | PBINRLSHOWXQOQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide?
The IUPAC name of N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide (CID 110486476) is N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide.
What is the SMILES notation for N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide?
The canonical SMILES for N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide is NCCNC(=O)C1(c2ccc(F)c(F)c2F)CC1.
What is the InChIKey of N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide?
The InChIKey is PBINRLSHOWXQOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N2O/c13-8-2-1-7(9(14)10(8)15)12(3-4-12)11(18)17-6-5-16/h1-2H,3-6,16H2,(H,17,18).
What are the key properties of N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide?
N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide has a molecular weight of 258.24 g/mol, XLogP of 1.21, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-1-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide is sourced from PubChem (CID 110486476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).