C12H13FN4O2 — CID 110486515
1-(3-amino-1,2,4-triazol-1-yl)-4-(2-fluorophenoxy)butan-1-one (PubChem CID 110486515) has the molecular formula C12H13FN4O2 and a molecular weight of 264.26 g/mol. Its IUPAC name is 1-(3-amino-1,2,4-triazol-1-yl)-4-(2-fluorophenoxy)butan-1-one.
| Compound Name | 1-(3-amino-1,2,4-triazol-1-yl)-4-(2-fluorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 110486515 |
| Molecular Formula | C12H13FN4O2 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-(3-amino-1,2,4-triazol-1-yl)-4-(2-fluorophenoxy)butan-1-one |
| SMILES | Nc1ncn(C(=O)CCCOc2ccccc2F)n1 |
| InChI | InChI=1S/C12H13FN4O2/c13-9-4-1-2-5-10(9)19-7-3-6-11(18)17-8-15-12(14)16-17/h1-2,4-5,8H,3,6-7H2,(H2,14,16) |
| InChIKey | DSRKIEJDCREZGG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|