C12H10FNO3 — CID 110486839
6-fluoro-N,N-dimethyl-2-oxochromene-3-carboxamide (PubChem CID 110486839) has the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. Its IUPAC name is 6-fluoro-N,N-dimethyl-2-oxochromene-3-carboxamide.
| Compound Name | 6-fluoro-N,N-dimethyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 110486839 |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 6-fluoro-N,N-dimethyl-2-oxochromene-3-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cc(F)ccc2oc1=O |
| InChI | InChI=1S/C12H10FNO3/c1-14(2)11(15)9-6-7-5-8(13)3-4-10(7)17-12(9)16/h3-6H,1-2H3 |
| InChIKey | QLTKHULFKZPUTQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|