C19H12F4N2O4 — CID 91643379
N-[2-acetamido-5-(trifluoromethyl)phenyl]-6-fluoro-2-oxochromene-3-carboxamide (PubChem CID 91643379) has the molecular formula C19H12F4N2O4 and a molecular weight of 408.31 g/mol. Its IUPAC name is N-[2-acetamido-5-(trifluoromethyl)phenyl]-6-fluoro-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-acetamido-5-(trifluoromethyl)phenyl]-6-fluoro-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 91643379 |
| Molecular Formula | C19H12F4N2O4 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-[2-acetamido-5-(trifluoromethyl)phenyl]-6-fluoro-2-oxochromene-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(F)(F)F)cc1NC(=O)c1cc2cc(F)ccc2oc1=O |
| InChI | InChI=1S/C19H12F4N2O4/c1-9(26)24-14-4-2-11(19(21,22)23)8-15(14)25-17(27)13-7-10-6-12(20)3-5-16(10)29-18(13)28/h2-8H,1H3,(H,24,26)(H,25,27) |
| InChIKey | FFKMTTBVFJRUQN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|