C13H21N3O2 — CID 110487358
3-(2-ethoxypyrimidin-5-yl)-N,N-diethylpropanamide (PubChem CID 110487358) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-(2-ethoxypyrimidin-5-yl)-N,N-diethylpropanamide.
| Compound Name | 3-(2-ethoxypyrimidin-5-yl)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 110487358 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 3-(2-ethoxypyrimidin-5-yl)-N,N-diethylpropanamide |
| SMILES | CCOc1ncc(CCC(=O)N(CC)CC)cn1 |
| InChI | InChI=1S/C13H21N3O2/c1-4-16(5-2)12(17)8-7-11-9-14-13(15-10-11)18-6-3/h9-10H,4-8H2,1-3H3 |
| InChIKey | HYLXJCPRABHMEH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |