About 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one
1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one (PubChem CID 110487326) has the molecular formula C11H14N6O2
and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one |
| PubChem CID | 110487326 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one |
| SMILES | CCOc1ncc(CCC(=O)n2cnc(N)n2)cn1 |
| InChI | InChI=1S/C11H14N6O2/c1-2-19-11-13-5-8(6-14-11)3-4-9(18)17-7-15-10(12)16-17/h5-7H,2-4H2,1H3,(H2,12,16) |
| InChIKey | MTNJPACWHJLOSV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one?
The IUPAC name of 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one (CID 110487326) is 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one.
What is the SMILES notation for 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one?
The canonical SMILES for 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one is CCOc1ncc(CCC(=O)n2cnc(N)n2)cn1.
What is the InChIKey of 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one?
The InChIKey is MTNJPACWHJLOSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N6O2/c1-2-19-11-13-5-8(6-14-11)3-4-9(18)17-7-15-10(12)16-17/h5-7H,2-4H2,1H3,(H2,12,16).
What are the key properties of 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one?
1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one has a molecular weight of 262.27 g/mol, XLogP of 0.32, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-1,2,4-triazol-1-yl)-3-(2-ethoxypyrimidin-5-yl)propan-1-one is sourced from PubChem (CID 110487326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).