C14H16F3NO — CID 110487580
1-(4-methylpiperidin-1-yl)-2-(2,4,6-trifluorophenyl)ethanone (PubChem CID 110487580) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-2-(2,4,6-trifluorophenyl)ethanone.
| Compound Name | 1-(4-methylpiperidin-1-yl)-2-(2,4,6-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 110487580 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-2-(2,4,6-trifluorophenyl)ethanone |
| SMILES | CC1CCN(C(=O)Cc2c(F)cc(F)cc2F)CC1 |
| InChI | InChI=1S/C14H16F3NO/c1-9-2-4-18(5-3-9)14(19)8-11-12(16)6-10(15)7-13(11)17/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | ZIAMATHICMSTFM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |