C15H24N2O2 — CID 110487966
2-pyridin-3-yloxy-N-(2,4,4-trimethylpentan-2-yl)acetamide (PubChem CID 110487966) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-pyridin-3-yloxy-N-(2,4,4-trimethylpentan-2-yl)acetamide.
| Compound Name | 2-pyridin-3-yloxy-N-(2,4,4-trimethylpentan-2-yl)acetamide |
|---|---|
| PubChem CID | 110487966 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-pyridin-3-yloxy-N-(2,4,4-trimethylpentan-2-yl)acetamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)COc1cccnc1 |
| InChI | InChI=1S/C15H24N2O2/c1-14(2,3)11-15(4,5)17-13(18)10-19-12-7-6-8-16-9-12/h6-9H,10-11H2,1-5H3,(H,17,18) |
| InChIKey | IEMWMEMUCMIOKE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |